C18H25ClN3OS+ — CID 7124819
3-[(2-chloroacetyl)-(4-phenyl-1,3-thiazol-2-yl)amino]propyl-diethylazanium (PubChem CID 7124819) has the molecular formula C18H25ClN3OS+ and a molecular weight of 366.94 g/mol. Its IUPAC name is 3-[(2-chloroacetyl)-(4-phenyl-1,3-thiazol-2-yl)amino]propyl-diethylazanium.
| Compound Name | 3-[(2-chloroacetyl)-(4-phenyl-1,3-thiazol-2-yl)amino]propyl-diethylazanium |
|---|---|
| PubChem CID | 7124819 |
| Molecular Formula | C18H25ClN3OS+ |
| Molecular Weight | 366.94 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 3-[(2-chloroacetyl)-(4-phenyl-1,3-thiazol-2-yl)amino]propyl-diethylazanium |
| SMILES | CC[NH+](CC)CCCN(C(=O)CCl)c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C18H24ClN3OS/c1-3-21(4-2)11-8-12-22(17(23)13-19)18-20-16(14-24-18)15-9-6-5-7-10-15/h5-7,9-10,14H,3-4,8,11-13H2,1-2H3/p+1 |
| InChIKey | YBUBBJOQURPXSC-UHFFFAOYSA-O |
| XLogP | 2.70 |
| TPSA | 37.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.94 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|