C22H25ClN4O3S — CID 166336189
[2-[hexyl-(4-phenyl-1,3-thiazol-2-yl)amino]-2-oxoethyl] 4-chloro-1-methylpyrazole-3-carboxylate (PubChem CID 166336189) has the molecular formula C22H25ClN4O3S and a molecular weight of 460.99 g/mol. Its IUPAC name is [2-[hexyl-(4-phenyl-1,3-thiazol-2-yl)amino]-2-oxoethyl] 4-chloro-1-methylpyrazole-3-carboxylate.
| Compound Name | [2-[hexyl-(4-phenyl-1,3-thiazol-2-yl)amino]-2-oxoethyl] 4-chloro-1-methylpyrazole-3-carboxylate |
|---|---|
| PubChem CID | 166336189 |
| Molecular Formula | C22H25ClN4O3S |
| Molecular Weight | 460.99 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | [2-[hexyl-(4-phenyl-1,3-thiazol-2-yl)amino]-2-oxoethyl] 4-chloro-1-methylpyrazole-3-carboxylate |
| SMILES | CCCCCCN(C(=O)COC(=O)c1nn(C)cc1Cl)c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C22H25ClN4O3S/c1-3-4-5-9-12-27(22-24-18(15-31-22)16-10-7-6-8-11-16)19(28)14-30-21(29)20-17(23)13-26(2)25-20/h6-8,10-11,13,15H,3-5,9,12,14H2,1-2H3 |
| InChIKey | YRCSBPDXPMUNMH-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.99 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|