C22H25N3O3S2 — CID 55998485
[2-[hexyl-(4-phenyl-1,3-thiazol-2-yl)amino]-2-oxoethyl] 4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 55998485) has the molecular formula C22H25N3O3S2 and a molecular weight of 443.59 g/mol. Its IUPAC name is [2-[hexyl-(4-phenyl-1,3-thiazol-2-yl)amino]-2-oxoethyl] 4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | [2-[hexyl-(4-phenyl-1,3-thiazol-2-yl)amino]-2-oxoethyl] 4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 55998485 |
| Molecular Formula | C22H25N3O3S2 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | [2-[hexyl-(4-phenyl-1,3-thiazol-2-yl)amino]-2-oxoethyl] 4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | CCCCCCN(C(=O)COC(=O)c1scnc1C)c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C22H25N3O3S2/c1-3-4-5-9-12-25(19(26)13-28-21(27)20-16(2)23-15-30-20)22-24-18(14-29-22)17-10-7-6-8-11-17/h6-8,10-11,14-15H,3-5,9,12-13H2,1-2H3 |
| InChIKey | LFWAOXXWXMBRFF-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|