C33H35N3O2S — CID 142249323
4-cyclohexyl-N-[4-[2-[(4-formylphenyl)methyl-propan-2-ylamino]-1,3-thiazol-4-yl]phenyl]benzamide (PubChem CID 142249323) has the molecular formula C33H35N3O2S and a molecular weight of 537.73 g/mol. Its IUPAC name is 4-cyclohexyl-N-[4-[2-[(4-formylphenyl)methyl-propan-2-ylamino]-1,3-thiazol-4-yl]phenyl]benzamide.
| Compound Name | 4-cyclohexyl-N-[4-[2-[(4-formylphenyl)methyl-propan-2-ylamino]-1,3-thiazol-4-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 142249323 |
| Molecular Formula | C33H35N3O2S |
| Molecular Weight | 537.73 g/mol |
| Exact Mass | 537.24 |
| IUPAC Name | 4-cyclohexyl-N-[4-[2-[(4-formylphenyl)methyl-propan-2-ylamino]-1,3-thiazol-4-yl]phenyl]benzamide |
| SMILES | CC(C)N(Cc1ccc(C=O)cc1)c1nc(-c2ccc(NC(=O)c3ccc(C4CCCCC4)cc3)cc2)cs1 |
| InChI | InChI=1S/C33H35N3O2S/c1-23(2)36(20-24-8-10-25(21-37)11-9-24)33-35-31(22-39-33)28-16-18-30(19-17-28)34-32(38)29-14-12-27(13-15-29)26-6-4-3-5-7-26/h8-19,21-23,26H,3-7,20H2,1-2H3,(H,34,38) |
| InChIKey | CUSLKRYTGDMGCX-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.73 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|