C31H30N2O2S — CID 142249348
4-cyclohexyl-N-[4-[2-[2-(3-formylphenyl)ethyl]-1,3-thiazol-4-yl]phenyl]benzamide (PubChem CID 142249348) has the molecular formula C31H30N2O2S and a molecular weight of 494.66 g/mol. Its IUPAC name is 4-cyclohexyl-N-[4-[2-[2-(3-formylphenyl)ethyl]-1,3-thiazol-4-yl]phenyl]benzamide.
| Compound Name | 4-cyclohexyl-N-[4-[2-[2-(3-formylphenyl)ethyl]-1,3-thiazol-4-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 142249348 |
| Molecular Formula | C31H30N2O2S |
| Molecular Weight | 494.66 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | 4-cyclohexyl-N-[4-[2-[2-(3-formylphenyl)ethyl]-1,3-thiazol-4-yl]phenyl]benzamide |
| SMILES | O=Cc1cccc(CCc2nc(-c3ccc(NC(=O)c4ccc(C5CCCCC5)cc4)cc3)cs2)c1 |
| InChI | InChI=1S/C31H30N2O2S/c34-20-23-6-4-5-22(19-23)9-18-30-33-29(21-36-30)26-14-16-28(17-15-26)32-31(35)27-12-10-25(11-13-27)24-7-2-1-3-8-24/h4-6,10-17,19-21,24H,1-3,7-9,18H2,(H,32,35) |
| InChIKey | QVEYEESKSRRIGO-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.66 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|