C21H22N6O2 — CID 22501855
1-N-(4-cyclohexylphenyl)-4-N-(2H-tetrazol-5-yl)benzene-1,4-dicarboxamide (PubChem CID 22501855) has the molecular formula C21H22N6O2 and a molecular weight of 390.45 g/mol. Its IUPAC name is 1-N-(4-cyclohexylphenyl)-4-N-(2H-tetrazol-5-yl)benzene-1,4-dicarboxamide.
| Compound Name | 1-N-(4-cyclohexylphenyl)-4-N-(2H-tetrazol-5-yl)benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 22501855 |
| Molecular Formula | C21H22N6O2 |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 1-N-(4-cyclohexylphenyl)-4-N-(2H-tetrazol-5-yl)benzene-1,4-dicarboxamide |
| SMILES | O=C(Nc1ccc(C2CCCCC2)cc1)c1ccc(C(=O)Nc2nn[nH]n2)cc1 |
| InChI | InChI=1S/C21H22N6O2/c28-19(22-18-12-10-15(11-13-18)14-4-2-1-3-5-14)16-6-8-17(9-7-16)20(29)23-21-24-26-27-25-21/h6-14H,1-5H2,(H,22,28)(H2,23,24,25,26,27,29) |
| InChIKey | LZHDPNZMBHMQAQ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |