C28H27ClN6O2 — CID 59117033
3-chloro-N-(4-cyclohexylphenyl)-N-[[4-(2H-tetrazol-5-ylcarbamoyl)phenyl]methyl]benzamide (PubChem CID 59117033) has the molecular formula C28H27ClN6O2 and a molecular weight of 515.02 g/mol. Its IUPAC name is 3-chloro-N-(4-cyclohexylphenyl)-N-[[4-(2H-tetrazol-5-ylcarbamoyl)phenyl]methyl]benzamide.
| Compound Name | 3-chloro-N-(4-cyclohexylphenyl)-N-[[4-(2H-tetrazol-5-ylcarbamoyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 59117033 |
| Molecular Formula | C28H27ClN6O2 |
| Molecular Weight | 515.02 g/mol |
| Exact Mass | 514.19 |
| IUPAC Name | 3-chloro-N-(4-cyclohexylphenyl)-N-[[4-(2H-tetrazol-5-ylcarbamoyl)phenyl]methyl]benzamide |
| SMILES | O=C(Nc1nn[nH]n1)c1ccc(CN(C(=O)c2cccc(Cl)c2)c2ccc(C3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C28H27ClN6O2/c29-24-8-4-7-23(17-24)27(37)35(25-15-13-21(14-16-25)20-5-2-1-3-6-20)18-19-9-11-22(12-10-19)26(36)30-28-31-33-34-32-28/h4,7-17,20H,1-3,5-6,18H2,(H2,30,31,32,33,34,36) |
| InChIKey | UWTYVAQSFLUQNI-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.02 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |