C30H29Cl2F3N8O — CID 59123058
4-[(4-cyclohexyl-N-[N-(3,5-dichlorophenyl)-N'-(2,2,2-trifluoroethyl)carbamimidoyl]anilino)methyl]-N-(2H-tetrazol-5-yl)benzamide (PubChem CID 59123058) has the molecular formula C30H29Cl2F3N8O and a molecular weight of 645.52 g/mol. Its IUPAC name is 4-[(4-cyclohexyl-N-[N-(3,5-dichlorophenyl)-N'-(2,2,2-trifluoroethyl)carbamimidoyl]anilino)methyl]-N-(2H-tetrazol-5-yl)benzamide.
| Compound Name | 4-[(4-cyclohexyl-N-[N-(3,5-dichlorophenyl)-N'-(2,2,2-trifluoroethyl)carbamimidoyl]anilino)methyl]-N-(2H-tetrazol-5-yl)benzamide |
|---|---|
| PubChem CID | 59123058 |
| Molecular Formula | C30H29Cl2F3N8O |
| Molecular Weight | 645.52 g/mol |
| Exact Mass | 644.18 |
| IUPAC Name | 4-[(4-cyclohexyl-N-[N-(3,5-dichlorophenyl)-N'-(2,2,2-trifluoroethyl)carbamimidoyl]anilino)methyl]-N-(2H-tetrazol-5-yl)benzamide |
| SMILES | O=C(Nc1nn[nH]n1)c1ccc(CN(/C(=N/CC(F)(F)F)Nc2cc(Cl)cc(Cl)c2)c2ccc(C3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C30H29Cl2F3N8O/c31-23-14-24(32)16-25(15-23)37-29(36-18-30(33,34)35)43(26-12-10-21(11-13-26)20-4-2-1-3-5-20)17-19-6-8-22(9-7-19)27(44)38-28-39-41-42-40-28/h6-16,20H,1-5,17-18H2,(H,36,37)(H2,38,39,40,41,42,44) |
| InChIKey | DTMSLRKTGNFYLN-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 111.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.52 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|