C32H29F6N9O — CID 59123124
4-[(N-[N-[3,5-bis(trifluoromethyl)phenyl]-N'-(cyanomethyl)carbamimidoyl]-4-cyclohexylanilino)methyl]-N-(2H-tetrazol-5-yl)benzamide (PubChem CID 59123124) has the molecular formula C32H29F6N9O and a molecular weight of 669.63 g/mol. Its IUPAC name is 4-[(N-[N-[3,5-bis(trifluoromethyl)phenyl]-N'-(cyanomethyl)carbamimidoyl]-4-cyclohexylanilino)methyl]-N-(2H-tetrazol-5-yl)benzamide.
| Compound Name | 4-[(N-[N-[3,5-bis(trifluoromethyl)phenyl]-N'-(cyanomethyl)carbamimidoyl]-4-cyclohexylanilino)methyl]-N-(2H-tetrazol-5-yl)benzamide |
|---|---|
| PubChem CID | 59123124 |
| Molecular Formula | C32H29F6N9O |
| Molecular Weight | 669.63 g/mol |
| Exact Mass | 669.24 |
| IUPAC Name | 4-[(N-[N-[3,5-bis(trifluoromethyl)phenyl]-N'-(cyanomethyl)carbamimidoyl]-4-cyclohexylanilino)methyl]-N-(2H-tetrazol-5-yl)benzamide |
| SMILES | N#CC/N=C(/Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)N(Cc1ccc(C(=O)Nc2nn[nH]n2)cc1)c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C32H29F6N9O/c33-31(34,35)24-16-25(32(36,37)38)18-26(17-24)41-30(40-15-14-39)47(27-12-10-22(11-13-27)21-4-2-1-3-5-21)19-20-6-8-23(9-7-20)28(48)42-29-43-45-46-44-29/h6-13,16-18,21H,1-5,15,19H2,(H,40,41)(H2,42,43,44,45,46,48) |
| InChIKey | IUGBRZDPZBYQTK-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 134.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.63 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|