C30H33F6N9O — CID 59123093
4-[[[N-[3,5-bis(trifluoromethyl)phenyl]-N'-(cyanomethyl)carbamimidoyl]-(4-tert-butylcyclohexyl)amino]methyl]-N-(2H-tetrazol-5-yl)benzamide (PubChem CID 59123093) has the molecular formula C30H33F6N9O and a molecular weight of 649.64 g/mol. Its IUPAC name is 4-[[[N-[3,5-bis(trifluoromethyl)phenyl]-N'-(cyanomethyl)carbamimidoyl]-(4-tert-butylcyclohexyl)amino]methyl]-N-(2H-tetrazol-5-yl)benzamide.
| Compound Name | 4-[[[N-[3,5-bis(trifluoromethyl)phenyl]-N'-(cyanomethyl)carbamimidoyl]-(4-tert-butylcyclohexyl)amino]methyl]-N-(2H-tetrazol-5-yl)benzamide |
|---|---|
| PubChem CID | 59123093 |
| Molecular Formula | C30H33F6N9O |
| Molecular Weight | 649.64 g/mol |
| Exact Mass | 649.27 |
| IUPAC Name | 4-[[[N-[3,5-bis(trifluoromethyl)phenyl]-N'-(cyanomethyl)carbamimidoyl]-(4-tert-butylcyclohexyl)amino]methyl]-N-(2H-tetrazol-5-yl)benzamide |
| SMILES | CC(C)(C)C1CCC(N(Cc2ccc(C(=O)Nc3nn[nH]n3)cc2)/C(=N\CC#N)Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C30H33F6N9O/c1-28(2,3)20-8-10-24(11-9-20)45(17-18-4-6-19(7-5-18)25(46)40-26-41-43-44-42-26)27(38-13-12-37)39-23-15-21(29(31,32)33)14-22(16-23)30(34,35)36/h4-7,14-16,20,24H,8-11,13,17H2,1-3H3,(H,38,39)(H2,40,41,42,43,44,46) |
| InChIKey | IELMDWZVQKKLOS-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 134.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.64 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|