C29H33F3N6O2 — CID 23550059
4-[[(4-tert-butylcyclohexyl)-[(E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoyl]amino]methyl]-N-(2H-tetrazol-5-yl)benzamide (PubChem CID 23550059) has the molecular formula C29H33F3N6O2 and a molecular weight of 554.62 g/mol. Its IUPAC name is 4-[[(4-tert-butylcyclohexyl)-[(E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoyl]amino]methyl]-N-(2H-tetrazol-5-yl)benzamide.
| Compound Name | 4-[[(4-tert-butylcyclohexyl)-[(E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoyl]amino]methyl]-N-(2H-tetrazol-5-yl)benzamide |
|---|---|
| PubChem CID | 23550059 |
| Molecular Formula | C29H33F3N6O2 |
| Molecular Weight | 554.62 g/mol |
| Exact Mass | 554.26 |
| IUPAC Name | 4-[[(4-tert-butylcyclohexyl)-[(E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoyl]amino]methyl]-N-(2H-tetrazol-5-yl)benzamide |
| SMILES | CC(C)(C)C1CCC(N(Cc2ccc(C(=O)Nc3nn[nH]n3)cc2)C(=O)/C=C/c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C29H33F3N6O2/c1-28(2,3)22-12-14-24(15-13-22)38(25(39)16-9-19-5-4-6-23(17-19)29(30,31)32)18-20-7-10-21(11-8-20)26(40)33-27-34-36-37-35-27/h4-11,16-17,22,24H,12-15,18H2,1-3H3,(H2,33,34,35,36,37,40)/b16-9+ |
| InChIKey | YTGOAUFOHDGYAU-CXUHLZMHSA-N |
| XLogP | 6.12 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.62 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|