C29H34F3N5O2 — CID 142027412
N-[amino(diazenyl)methylidene]-4-[[(4-tert-butylcyclohexyl)-[(E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoyl]amino]methyl]benzamide (PubChem CID 142027412) has the molecular formula C29H34F3N5O2 and a molecular weight of 541.62 g/mol. Its IUPAC name is N-[amino(diazenyl)methylidene]-4-[[(4-tert-butylcyclohexyl)-[(E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoyl]amino]methyl]benzamide.
| Compound Name | N-[amino(diazenyl)methylidene]-4-[[(4-tert-butylcyclohexyl)-[(E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 142027412 |
| Molecular Formula | C29H34F3N5O2 |
| Molecular Weight | 541.62 g/mol |
| Exact Mass | 541.27 |
| IUPAC Name | N-[amino(diazenyl)methylidene]-4-[[(4-tert-butylcyclohexyl)-[(E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoyl]amino]methyl]benzamide |
| SMILES | [H]/N=N/C(N)=N\C(=O)c1ccc(CN(C(=O)/C=C/c2cccc(C(F)(F)F)c2)C2CCC(C(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C29H34F3N5O2/c1-28(2,3)22-12-14-24(15-13-22)37(18-20-7-10-21(11-8-20)26(39)35-27(33)36-34)25(38)16-9-19-5-4-6-23(17-19)29(30,31)32/h4-11,16-17,22,24,34H,12-15,18H2,1-3H3,(H2,33,35,39)/b16-9+,36-34+ |
| InChIKey | WTBXAVQMSDPLQD-PPLGZIKDSA-N |
| XLogP | 6.84 |
| TPSA | 111.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.62 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|