C21H30F3NO — CID 5353236
(E)-N-decyl-N-methyl-3-[3-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 5353236) has the molecular formula C21H30F3NO and a molecular weight of 369.47 g/mol. Its IUPAC name is (E)-N-decyl-N-methyl-3-[3-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-decyl-N-methyl-3-[3-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 5353236 |
| Molecular Formula | C21H30F3NO |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | (E)-N-decyl-N-methyl-3-[3-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | CCCCCCCCCCN(C)C(=O)/C=C/c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H30F3NO/c1-3-4-5-6-7-8-9-10-16-25(2)20(26)15-14-18-12-11-13-19(17-18)21(22,23)24/h11-15,17H,3-10,16H2,1-2H3/b15-14+ |
| InChIKey | ZMGRFNXTKZZOBA-CCEZHUSRSA-N |
| XLogP | 6.32 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|