C16H23NO2 — CID 107202427
(E)-N-(5-hydroxypentyl)-N-methyl-3-(3-methylphenyl)prop-2-enamide (PubChem CID 107202427) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is (E)-N-(5-hydroxypentyl)-N-methyl-3-(3-methylphenyl)prop-2-enamide.
| Compound Name | (E)-N-(5-hydroxypentyl)-N-methyl-3-(3-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 107202427 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | (E)-N-(5-hydroxypentyl)-N-methyl-3-(3-methylphenyl)prop-2-enamide |
| SMILES | Cc1cccc(/C=C/C(=O)N(C)CCCCCO)c1 |
| InChI | InChI=1S/C16H23NO2/c1-14-7-6-8-15(13-14)9-10-16(19)17(2)11-4-3-5-12-18/h6-10,13,18H,3-5,11-12H2,1-2H3/b10-9+ |
| InChIKey | UECXHCUKBWLHHT-MDZDMXLPSA-N |
| XLogP | 2.63 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|