C27H33F3N6O2 — CID 90993094
N-(4-tert-butylcyclohexyl)-N-[[4-(didiazenylmethylcarbamoyl)phenyl]methyl]-3-(trifluoromethyl)benzamide (PubChem CID 90993094) has the molecular formula C27H33F3N6O2 and a molecular weight of 530.60 g/mol. Its IUPAC name is N-(4-tert-butylcyclohexyl)-N-[[4-(didiazenylmethylcarbamoyl)phenyl]methyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-(4-tert-butylcyclohexyl)-N-[[4-(didiazenylmethylcarbamoyl)phenyl]methyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 90993094 |
| Molecular Formula | C27H33F3N6O2 |
| Molecular Weight | 530.60 g/mol |
| Exact Mass | 530.26 |
| IUPAC Name | N-(4-tert-butylcyclohexyl)-N-[[4-(didiazenylmethylcarbamoyl)phenyl]methyl]-3-(trifluoromethyl)benzamide |
| SMILES | [H]/N=N/C(/N=N/[H])NC(=O)c1ccc(CN(C(=O)c2cccc(C(F)(F)F)c2)C2CCC(C(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C27H33F3N6O2/c1-26(2,3)20-11-13-22(14-12-20)36(24(38)19-5-4-6-21(15-19)27(28,29)30)16-17-7-9-18(10-8-17)23(37)33-25(34-31)35-32/h4-10,15,20,22,25,31-32H,11-14,16H2,1-3H3,(H,33,37)/b34-31+,35-32+ |
| InChIKey | RRUXDAHXLBAOMY-UTMVNRITSA-N |
| XLogP | 7.03 |
| TPSA | 121.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.60 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|