C20H16F6N2O2 — CID 38371299
N-[(4-carbamoylphenyl)methyl]-N-cyclopropyl-3,5-bis(trifluoromethyl)benzamide (PubChem CID 38371299) has the molecular formula C20H16F6N2O2 and a molecular weight of 430.35 g/mol. Its IUPAC name is N-[(4-carbamoylphenyl)methyl]-N-cyclopropyl-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-[(4-carbamoylphenyl)methyl]-N-cyclopropyl-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 38371299 |
| Molecular Formula | C20H16F6N2O2 |
| Molecular Weight | 430.35 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | N-[(4-carbamoylphenyl)methyl]-N-cyclopropyl-3,5-bis(trifluoromethyl)benzamide |
| SMILES | NC(=O)c1ccc(CN(C(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)C2CC2)cc1 |
| InChI | InChI=1S/C20H16F6N2O2/c21-19(22,23)14-7-13(8-15(9-14)20(24,25)26)18(30)28(16-5-6-16)10-11-1-3-12(4-2-11)17(27)29/h1-4,7-9,16H,5-6,10H2,(H2,27,29) |
| InChIKey | MSMIETFUJUEMBK-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.35 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |