C20H19F3N2O4S — CID 37154016
4-[[cyclopropyl-[4-(trifluoromethylsulfonyl)benzoyl]amino]methyl]-N-methylbenzamide (PubChem CID 37154016) has the molecular formula C20H19F3N2O4S and a molecular weight of 440.44 g/mol. Its IUPAC name is 4-[[cyclopropyl-[4-(trifluoromethylsulfonyl)benzoyl]amino]methyl]-N-methylbenzamide.
| Compound Name | 4-[[cyclopropyl-[4-(trifluoromethylsulfonyl)benzoyl]amino]methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 37154016 |
| Molecular Formula | C20H19F3N2O4S |
| Molecular Weight | 440.44 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | 4-[[cyclopropyl-[4-(trifluoromethylsulfonyl)benzoyl]amino]methyl]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(CN(C(=O)c2ccc(S(=O)(=O)C(F)(F)F)cc2)C2CC2)cc1 |
| InChI | InChI=1S/C20H19F3N2O4S/c1-24-18(26)14-4-2-13(3-5-14)12-25(16-8-9-16)19(27)15-6-10-17(11-7-15)30(28,29)20(21,22)23/h2-7,10-11,16H,8-9,12H2,1H3,(H,24,26) |
| InChIKey | BXEUDHDGXGXAAA-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.44 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |