C17H15F3N2O3S — CID 37028672
N-cyclopropyl-N-(pyridin-3-ylmethyl)-4-(trifluoromethylsulfonyl)benzamide (PubChem CID 37028672) has the molecular formula C17H15F3N2O3S and a molecular weight of 384.38 g/mol. Its IUPAC name is N-cyclopropyl-N-(pyridin-3-ylmethyl)-4-(trifluoromethylsulfonyl)benzamide.
| Compound Name | N-cyclopropyl-N-(pyridin-3-ylmethyl)-4-(trifluoromethylsulfonyl)benzamide |
|---|---|
| PubChem CID | 37028672 |
| Molecular Formula | C17H15F3N2O3S |
| Molecular Weight | 384.38 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | N-cyclopropyl-N-(pyridin-3-ylmethyl)-4-(trifluoromethylsulfonyl)benzamide |
| SMILES | O=C(c1ccc(S(=O)(=O)C(F)(F)F)cc1)N(Cc1cccnc1)C1CC1 |
| InChI | InChI=1S/C17H15F3N2O3S/c18-17(19,20)26(24,25)15-7-3-13(4-8-15)16(23)22(14-5-6-14)11-12-2-1-9-21-10-12/h1-4,7-10,14H,5-6,11H2 |
| InChIKey | LYRYAJHEDIFIHS-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.38 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |