C16H18N4O — CID 61139944
2,4-diamino-N-cyclopropyl-N-(pyridin-3-ylmethyl)benzamide (PubChem CID 61139944) has the molecular formula C16H18N4O and a molecular weight of 282.35 g/mol. Its IUPAC name is 2,4-diamino-N-cyclopropyl-N-(pyridin-3-ylmethyl)benzamide.
| Compound Name | 2,4-diamino-N-cyclopropyl-N-(pyridin-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 61139944 |
| Molecular Formula | C16H18N4O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 2,4-diamino-N-cyclopropyl-N-(pyridin-3-ylmethyl)benzamide |
| SMILES | Nc1ccc(C(=O)N(Cc2cccnc2)C2CC2)c(N)c1 |
| InChI | InChI=1S/C16H18N4O/c17-12-3-6-14(15(18)8-12)16(21)20(13-4-5-13)10-11-2-1-7-19-9-11/h1-3,6-9,13H,4-5,10,17-18H2 |
| InChIKey | CAPOXQPGXBQORE-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 85.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|