C21H26N4O5 — CID 70198989
cis-(1R,2S)-2-(pyridin-3-ylmethylcarbamoyl)cyclohexane-1-carboxylic acid;2,4-diaminobenzoic acid (PubChem CID 70198989) has the molecular formula C21H26N4O5 and a molecular weight of 414.46 g/mol. Its IUPAC name is cis-(1R,2S)-2-(pyridin-3-ylmethylcarbamoyl)cyclohexane-1-carboxylic acid;2,4-diaminobenzoic acid.
| Compound Name | cis-(1R,2S)-2-(pyridin-3-ylmethylcarbamoyl)cyclohexane-1-carboxylic acid;2,4-diaminobenzoic acid |
|---|---|
| PubChem CID | 70198989 |
| Molecular Formula | C21H26N4O5 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | cis-(1R,2S)-2-(pyridin-3-ylmethylcarbamoyl)cyclohexane-1-carboxylic acid;2,4-diaminobenzoic acid |
| SMILES | Nc1ccc(C(=O)O)c(N)c1.O=C(NCc1cccnc1)[C@H]1CCCC[C@H]1C(=O)O |
| InChI | InChI=1S/C14H18N2O3.C7H8N2O2/c17-13(16-9-10-4-3-7-15-8-10)11-5-1-2-6-12(11)14(18)19;8-4-1-2-5(7(10)11)6(9)3-4/h3-4,7-8,11-12H,1-2,5-6,9H2,(H,16,17)(H,18,19);1-3H,8-9H2,(H,10,11)/t11-,12+;/m0./s1 |
| InChIKey | UYBYDUVAWZKVHK-ZVWHLABXSA-N |
| XLogP | 2.14 |
| TPSA | 168.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|