C24H25N3O — CID 119064910
N-cyclopropyl-4-[3-(dimethylamino)phenyl]-N-(pyridin-3-ylmethyl)benzamide (PubChem CID 119064910) has the molecular formula C24H25N3O and a molecular weight of 371.48 g/mol. Its IUPAC name is N-cyclopropyl-4-[3-(dimethylamino)phenyl]-N-(pyridin-3-ylmethyl)benzamide.
| Compound Name | N-cyclopropyl-4-[3-(dimethylamino)phenyl]-N-(pyridin-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 119064910 |
| Molecular Formula | C24H25N3O |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | N-cyclopropyl-4-[3-(dimethylamino)phenyl]-N-(pyridin-3-ylmethyl)benzamide |
| SMILES | CN(C)c1cccc(-c2ccc(C(=O)N(Cc3cccnc3)C3CC3)cc2)c1 |
| InChI | InChI=1S/C24H25N3O/c1-26(2)23-7-3-6-21(15-23)19-8-10-20(11-9-19)24(28)27(22-12-13-22)17-18-5-4-14-25-16-18/h3-11,14-16,22H,12-13,17H2,1-2H3 |
| InChIKey | PRDVIMRZQARLSH-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |