C23H24N4O — CID 122564926
N-cyclopropyl-4-(3-cyclopropyl-5-methyl-1H-pyrazol-4-yl)-N-(pyridin-3-ylmethyl)benzamide (PubChem CID 122564926) has the molecular formula C23H24N4O and a molecular weight of 372.47 g/mol. Its IUPAC name is N-cyclopropyl-4-(3-cyclopropyl-5-methyl-1H-pyrazol-4-yl)-N-(pyridin-3-ylmethyl)benzamide.
| Compound Name | N-cyclopropyl-4-(3-cyclopropyl-5-methyl-1H-pyrazol-4-yl)-N-(pyridin-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 122564926 |
| Molecular Formula | C23H24N4O |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | N-cyclopropyl-4-(3-cyclopropyl-5-methyl-1H-pyrazol-4-yl)-N-(pyridin-3-ylmethyl)benzamide |
| SMILES | Cc1[nH]nc(C2CC2)c1-c1ccc(C(=O)N(Cc2cccnc2)C2CC2)cc1 |
| InChI | InChI=1S/C23H24N4O/c1-15-21(22(26-25-15)18-6-7-18)17-4-8-19(9-5-17)23(28)27(20-10-11-20)14-16-3-2-12-24-13-16/h2-5,8-9,12-13,18,20H,6-7,10-11,14H2,1H3,(H,25,26) |
| InChIKey | GGTBITKDDVLMGQ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |