C26H33N3O4 — CID 15380716
cyclohexyl 2-[4-[piperidin-4-yl(pyridin-3-ylmethyl)carbamoyl]phenoxy]acetate (PubChem CID 15380716) has the molecular formula C26H33N3O4 and a molecular weight of 451.57 g/mol. Its IUPAC name is cyclohexyl 2-[4-[piperidin-4-yl(pyridin-3-ylmethyl)carbamoyl]phenoxy]acetate.
| Compound Name | cyclohexyl 2-[4-[piperidin-4-yl(pyridin-3-ylmethyl)carbamoyl]phenoxy]acetate |
|---|---|
| PubChem CID | 15380716 |
| Molecular Formula | C26H33N3O4 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.25 |
| IUPAC Name | cyclohexyl 2-[4-[piperidin-4-yl(pyridin-3-ylmethyl)carbamoyl]phenoxy]acetate |
| SMILES | O=C(COc1ccc(C(=O)N(Cc2cccnc2)C2CCNCC2)cc1)OC1CCCCC1 |
| InChI | InChI=1S/C26H33N3O4/c30-25(33-24-6-2-1-3-7-24)19-32-23-10-8-21(9-11-23)26(31)29(22-12-15-27-16-13-22)18-20-5-4-14-28-17-20/h4-5,8-11,14,17,22,24,27H,1-3,6-7,12-13,15-16,18-19H2 |
| InChIKey | NPZABDCMMAZPMX-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |