C13H18N2O2 — CID 112738794
cyclopentyl N-methyl-N-(pyridin-3-ylmethyl)carbamate (PubChem CID 112738794) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is cyclopentyl N-methyl-N-(pyridin-3-ylmethyl)carbamate.
| Compound Name | cyclopentyl N-methyl-N-(pyridin-3-ylmethyl)carbamate |
|---|---|
| PubChem CID | 112738794 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | cyclopentyl N-methyl-N-(pyridin-3-ylmethyl)carbamate |
| SMILES | CN(Cc1cccnc1)C(=O)OC1CCCC1 |
| InChI | InChI=1S/C13H18N2O2/c1-15(10-11-5-4-8-14-9-11)13(16)17-12-6-2-3-7-12/h4-5,8-9,12H,2-3,6-7,10H2,1H3 |
| InChIKey | HMLDIJNYCIYXLG-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |