C15H21N3O — CID 71937848
3-cyclopentyl-1-cyclopropyl-1-(pyridin-3-ylmethyl)urea (PubChem CID 71937848) has the molecular formula C15H21N3O and a molecular weight of 259.35 g/mol. Its IUPAC name is 3-cyclopentyl-1-cyclopropyl-1-(pyridin-3-ylmethyl)urea.
| Compound Name | 3-cyclopentyl-1-cyclopropyl-1-(pyridin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 71937848 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | 3-cyclopentyl-1-cyclopropyl-1-(pyridin-3-ylmethyl)urea |
| SMILES | O=C(NC1CCCC1)N(Cc1cccnc1)C1CC1 |
| InChI | InChI=1S/C15H21N3O/c19-15(17-13-5-1-2-6-13)18(14-7-8-14)11-12-4-3-9-16-10-12/h3-4,9-10,13-14H,1-2,5-8,11H2,(H,17,19) |
| InChIKey | YSZOZDYZZGHUOY-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |