C19H18ClIN2O2 — CID 39881157
4-chloro-N-cyclopropyl-3-iodo-N-[[4-(methylcarbamoyl)phenyl]methyl]benzamide (PubChem CID 39881157) has the molecular formula C19H18ClIN2O2 and a molecular weight of 468.72 g/mol. Its IUPAC name is 4-chloro-N-cyclopropyl-3-iodo-N-[[4-(methylcarbamoyl)phenyl]methyl]benzamide.
| Compound Name | 4-chloro-N-cyclopropyl-3-iodo-N-[[4-(methylcarbamoyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 39881157 |
| Molecular Formula | C19H18ClIN2O2 |
| Molecular Weight | 468.72 g/mol |
| Exact Mass | 468.01 |
| IUPAC Name | 4-chloro-N-cyclopropyl-3-iodo-N-[[4-(methylcarbamoyl)phenyl]methyl]benzamide |
| SMILES | CNC(=O)c1ccc(CN(C(=O)c2ccc(Cl)c(I)c2)C2CC2)cc1 |
| InChI | InChI=1S/C19H18ClIN2O2/c1-22-18(24)13-4-2-12(3-5-13)11-23(15-7-8-15)19(25)14-6-9-16(20)17(21)10-14/h2-6,9-10,15H,7-8,11H2,1H3,(H,22,24) |
| InChIKey | XWRCRPXDIWHWLT-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.72 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|