C26H27N3O4S — CID 38371513
4-[[cyclopropyl-[4-[(3,4-dimethylphenyl)sulfamoyl]benzoyl]amino]methyl]benzamide (PubChem CID 38371513) has the molecular formula C26H27N3O4S and a molecular weight of 477.59 g/mol. Its IUPAC name is 4-[[cyclopropyl-[4-[(3,4-dimethylphenyl)sulfamoyl]benzoyl]amino]methyl]benzamide.
| Compound Name | 4-[[cyclopropyl-[4-[(3,4-dimethylphenyl)sulfamoyl]benzoyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 38371513 |
| Molecular Formula | C26H27N3O4S |
| Molecular Weight | 477.59 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | 4-[[cyclopropyl-[4-[(3,4-dimethylphenyl)sulfamoyl]benzoyl]amino]methyl]benzamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(C(=O)N(Cc3ccc(C(N)=O)cc3)C3CC3)cc2)cc1C |
| InChI | InChI=1S/C26H27N3O4S/c1-17-3-10-22(15-18(17)2)28-34(32,33)24-13-8-21(9-14-24)26(31)29(23-11-12-23)16-19-4-6-20(7-5-19)25(27)30/h3-10,13-15,23,28H,11-12,16H2,1-2H3,(H2,27,30) |
| InChIKey | FMQPYLOBMZSTRK-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.59 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |