C29H40F3N7O2 — CID 142027678
N-[1-amino-1-[(Z)-aminodiazenyl]ethyl]-4-[[(4-tert-butylcyclohexyl)-[[2-methyl-5-(trifluoromethyl)phenyl]carbamoyl]amino]methyl]benzamide (PubChem CID 142027678) has the molecular formula C29H40F3N7O2 and a molecular weight of 575.68 g/mol. Its IUPAC name is N-[1-amino-1-[(Z)-aminodiazenyl]ethyl]-4-[[(4-tert-butylcyclohexyl)-[[2-methyl-5-(trifluoromethyl)phenyl]carbamoyl]amino]methyl]benzamide.
| Compound Name | N-[1-amino-1-[(Z)-aminodiazenyl]ethyl]-4-[[(4-tert-butylcyclohexyl)-[[2-methyl-5-(trifluoromethyl)phenyl]carbamoyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 142027678 |
| Molecular Formula | C29H40F3N7O2 |
| Molecular Weight | 575.68 g/mol |
| Exact Mass | 575.32 |
| IUPAC Name | N-[1-amino-1-[(Z)-aminodiazenyl]ethyl]-4-[[(4-tert-butylcyclohexyl)-[[2-methyl-5-(trifluoromethyl)phenyl]carbamoyl]amino]methyl]benzamide |
| SMILES | Cc1ccc(C(F)(F)F)cc1NC(=O)N(Cc1ccc(C(=O)NC(C)(N)/N=N\N)cc1)C1CCC(C(C)(C)C)CC1 |
| InChI | InChI=1S/C29H40F3N7O2/c1-18-6-11-22(29(30,31)32)16-24(18)35-26(41)39(23-14-12-21(13-15-23)27(2,3)4)17-19-7-9-20(10-8-19)25(40)36-28(5,33)37-38-34/h6-11,16,21,23H,12-15,17,33H2,1-5H3,(H2,34,37)(H,35,41)(H,36,40) |
| InChIKey | LKFKAVZEVZXQDD-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.68 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|