C28H38N4O4 — CID 89175958
3-[[4-[[(4-aminophenyl)carbamoyl-(4-tert-butylcyclohexyl)amino]methyl]benzoyl]amino]propanoic acid (PubChem CID 89175958) has the molecular formula C28H38N4O4 and a molecular weight of 494.64 g/mol. Its IUPAC name is 3-[[4-[[(4-aminophenyl)carbamoyl-(4-tert-butylcyclohexyl)amino]methyl]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[[(4-aminophenyl)carbamoyl-(4-tert-butylcyclohexyl)amino]methyl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 89175958 |
| Molecular Formula | C28H38N4O4 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.29 |
| IUPAC Name | 3-[[4-[[(4-aminophenyl)carbamoyl-(4-tert-butylcyclohexyl)amino]methyl]benzoyl]amino]propanoic acid |
| SMILES | CC(C)(C)C1CCC(N(Cc2ccc(C(=O)NCCC(=O)O)cc2)C(=O)Nc2ccc(N)cc2)CC1 |
| InChI | InChI=1S/C28H38N4O4/c1-28(2,3)21-8-14-24(15-9-21)32(27(36)31-23-12-10-22(29)11-13-23)18-19-4-6-20(7-5-19)26(35)30-17-16-25(33)34/h4-7,10-13,21,24H,8-9,14-18,29H2,1-3H3,(H,30,35)(H,31,36)(H,33,34) |
| InChIKey | CJJKXUQVYDALEM-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 124.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|