C23H37N3O3 — CID 23550127
ethyl 3-[[4-[[amino-(4-tert-butylcyclohexyl)amino]methyl]benzoyl]amino]propanoate (PubChem CID 23550127) has the molecular formula C23H37N3O3 and a molecular weight of 403.57 g/mol. Its IUPAC name is ethyl 3-[[4-[[amino-(4-tert-butylcyclohexyl)amino]methyl]benzoyl]amino]propanoate.
| Compound Name | ethyl 3-[[4-[[amino-(4-tert-butylcyclohexyl)amino]methyl]benzoyl]amino]propanoate |
|---|---|
| PubChem CID | 23550127 |
| Molecular Formula | C23H37N3O3 |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.28 |
| IUPAC Name | ethyl 3-[[4-[[amino-(4-tert-butylcyclohexyl)amino]methyl]benzoyl]amino]propanoate |
| SMILES | CCOC(=O)CCNC(=O)c1ccc(CN(N)C2CCC(C(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C23H37N3O3/c1-5-29-21(27)14-15-25-22(28)18-8-6-17(7-9-18)16-26(24)20-12-10-19(11-13-20)23(2,3)4/h6-9,19-20H,5,10-16,24H2,1-4H3,(H,25,28) |
| InChIKey | WEIXXVIATIZXPL-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|