C22H24N2O3 — CID 7827849
(4-cyanophenyl)methyl 3-[(4-tert-butylbenzoyl)amino]propanoate (PubChem CID 7827849) has the molecular formula C22H24N2O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is (4-cyanophenyl)methyl 3-[(4-tert-butylbenzoyl)amino]propanoate.
| Compound Name | (4-cyanophenyl)methyl 3-[(4-tert-butylbenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 7827849 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | (4-cyanophenyl)methyl 3-[(4-tert-butylbenzoyl)amino]propanoate |
| SMILES | CC(C)(C)c1ccc(C(=O)NCCC(=O)OCc2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C22H24N2O3/c1-22(2,3)19-10-8-18(9-11-19)21(26)24-13-12-20(25)27-15-17-6-4-16(14-23)5-7-17/h4-11H,12-13,15H2,1-3H3,(H,24,26) |
| InChIKey | NPRFHUBNCVUGMA-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |