C19H25N3O4 — CID 7827758
[2-(2-cyanoethylamino)-2-oxoethyl] 3-[(4-tert-butylbenzoyl)amino]propanoate (PubChem CID 7827758) has the molecular formula C19H25N3O4 and a molecular weight of 359.43 g/mol. Its IUPAC name is [2-(2-cyanoethylamino)-2-oxoethyl] 3-[(4-tert-butylbenzoyl)amino]propanoate.
| Compound Name | [2-(2-cyanoethylamino)-2-oxoethyl] 3-[(4-tert-butylbenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 7827758 |
| Molecular Formula | C19H25N3O4 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | [2-(2-cyanoethylamino)-2-oxoethyl] 3-[(4-tert-butylbenzoyl)amino]propanoate |
| SMILES | CC(C)(C)c1ccc(C(=O)NCCC(=O)OCC(=O)NCCC#N)cc1 |
| InChI | InChI=1S/C19H25N3O4/c1-19(2,3)15-7-5-14(6-8-15)18(25)22-12-9-17(24)26-13-16(23)21-11-4-10-20/h5-8H,4,9,11-13H2,1-3H3,(H,21,23)(H,22,25) |
| InChIKey | WGGNRRJFRBUEDZ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|