C24H34N2O4 — CID 29459999
[2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] 3-[(4-tert-butylbenzoyl)amino]propanoate (PubChem CID 29459999) has the molecular formula C24H34N2O4 and a molecular weight of 414.55 g/mol. Its IUPAC name is [2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] 3-[(4-tert-butylbenzoyl)amino]propanoate.
| Compound Name | [2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] 3-[(4-tert-butylbenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 29459999 |
| Molecular Formula | C24H34N2O4 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.25 |
| IUPAC Name | [2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] 3-[(4-tert-butylbenzoyl)amino]propanoate |
| SMILES | CC(C)(C)c1ccc(C(=O)NCCC(=O)OCC(=O)NCCC2=CCCCC2)cc1 |
| InChI | InChI=1S/C24H34N2O4/c1-24(2,3)20-11-9-19(10-12-20)23(29)26-16-14-22(28)30-17-21(27)25-15-13-18-7-5-4-6-8-18/h7,9-12H,4-6,8,13-17H2,1-3H3,(H,25,27)(H,26,29) |
| InChIKey | CWBCVZQFJCPVSW-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|