C26H34N2O6 — CID 30029948
[2-(3,4-diethoxyanilino)-2-oxoethyl] 3-[(4-tert-butylbenzoyl)amino]propanoate (PubChem CID 30029948) has the molecular formula C26H34N2O6 and a molecular weight of 470.57 g/mol. Its IUPAC name is [2-(3,4-diethoxyanilino)-2-oxoethyl] 3-[(4-tert-butylbenzoyl)amino]propanoate.
| Compound Name | [2-(3,4-diethoxyanilino)-2-oxoethyl] 3-[(4-tert-butylbenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 30029948 |
| Molecular Formula | C26H34N2O6 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.24 |
| IUPAC Name | [2-(3,4-diethoxyanilino)-2-oxoethyl] 3-[(4-tert-butylbenzoyl)amino]propanoate |
| SMILES | CCOc1ccc(NC(=O)COC(=O)CCNC(=O)c2ccc(C(C)(C)C)cc2)cc1OCC |
| InChI | InChI=1S/C26H34N2O6/c1-6-32-21-13-12-20(16-22(21)33-7-2)28-23(29)17-34-24(30)14-15-27-25(31)18-8-10-19(11-9-18)26(3,4)5/h8-13,16H,6-7,14-15,17H2,1-5H3,(H,27,31)(H,28,29) |
| InChIKey | VDVRZVRWELSKJA-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |