C24H29NO7 — CID 4842334
[2-(3,4-diethoxyanilino)-2-oxoethyl] 4-(4-acetylphenoxy)butanoate (PubChem CID 4842334) has the molecular formula C24H29NO7 and a molecular weight of 443.50 g/mol. Its IUPAC name is [2-(3,4-diethoxyanilino)-2-oxoethyl] 4-(4-acetylphenoxy)butanoate.
| Compound Name | [2-(3,4-diethoxyanilino)-2-oxoethyl] 4-(4-acetylphenoxy)butanoate |
|---|---|
| PubChem CID | 4842334 |
| Molecular Formula | C24H29NO7 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | [2-(3,4-diethoxyanilino)-2-oxoethyl] 4-(4-acetylphenoxy)butanoate |
| SMILES | CCOc1ccc(NC(=O)COC(=O)CCCOc2ccc(C(C)=O)cc2)cc1OCC |
| InChI | InChI=1S/C24H29NO7/c1-4-29-21-13-10-19(15-22(21)30-5-2)25-23(27)16-32-24(28)7-6-14-31-20-11-8-18(9-12-20)17(3)26/h8-13,15H,4-7,14,16H2,1-3H3,(H,25,27) |
| InChIKey | BRZRRRRSKAZECS-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|