C21H19F2NO7 — CID 18271731
[2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-2-oxoethyl] 4-(4-acetylphenoxy)butanoate (PubChem CID 18271731) has the molecular formula C21H19F2NO7 and a molecular weight of 435.38 g/mol. Its IUPAC name is [2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-2-oxoethyl] 4-(4-acetylphenoxy)butanoate.
| Compound Name | [2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-2-oxoethyl] 4-(4-acetylphenoxy)butanoate |
|---|---|
| PubChem CID | 18271731 |
| Molecular Formula | C21H19F2NO7 |
| Molecular Weight | 435.38 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | [2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-2-oxoethyl] 4-(4-acetylphenoxy)butanoate |
| SMILES | CC(=O)c1ccc(OCCCC(=O)OCC(=O)Nc2ccc3c(c2)OC(F)(F)O3)cc1 |
| InChI | InChI=1S/C21H19F2NO7/c1-13(25)14-4-7-16(8-5-14)28-10-2-3-20(27)29-12-19(26)24-15-6-9-17-18(11-15)31-21(22,23)30-17/h4-9,11H,2-3,10,12H2,1H3,(H,24,26) |
| InChIKey | AVTFCCUIERKQHK-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.38 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|