C20H19F2NO7 — CID 5008005
[2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-2-oxoethyl] 4-(4-methoxyphenoxy)butanoate (PubChem CID 5008005) has the molecular formula C20H19F2NO7 and a molecular weight of 423.37 g/mol. Its IUPAC name is [2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-2-oxoethyl] 4-(4-methoxyphenoxy)butanoate.
| Compound Name | [2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-2-oxoethyl] 4-(4-methoxyphenoxy)butanoate |
|---|---|
| PubChem CID | 5008005 |
| Molecular Formula | C20H19F2NO7 |
| Molecular Weight | 423.37 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | [2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-2-oxoethyl] 4-(4-methoxyphenoxy)butanoate |
| SMILES | COc1ccc(OCCCC(=O)OCC(=O)Nc2ccc3c(c2)OC(F)(F)O3)cc1 |
| InChI | InChI=1S/C20H19F2NO7/c1-26-14-5-7-15(8-6-14)27-10-2-3-19(25)28-12-18(24)23-13-4-9-16-17(11-13)30-20(21,22)29-16/h4-9,11H,2-3,10,12H2,1H3,(H,23,24) |
| InChIKey | WFKYZVSGSGLKAL-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.37 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|