C24H27NO6 — CID 7431944
[2-[4-(butanoylamino)phenyl]-2-oxoethyl] 4-(4-acetylphenoxy)butanoate (PubChem CID 7431944) has the molecular formula C24H27NO6 and a molecular weight of 425.48 g/mol. Its IUPAC name is [2-[4-(butanoylamino)phenyl]-2-oxoethyl] 4-(4-acetylphenoxy)butanoate.
| Compound Name | [2-[4-(butanoylamino)phenyl]-2-oxoethyl] 4-(4-acetylphenoxy)butanoate |
|---|---|
| PubChem CID | 7431944 |
| Molecular Formula | C24H27NO6 |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | [2-[4-(butanoylamino)phenyl]-2-oxoethyl] 4-(4-acetylphenoxy)butanoate |
| SMILES | CCCC(=O)Nc1ccc(C(=O)COC(=O)CCCOc2ccc(C(C)=O)cc2)cc1 |
| InChI | InChI=1S/C24H27NO6/c1-3-5-23(28)25-20-11-7-19(8-12-20)22(27)16-31-24(29)6-4-15-30-21-13-9-18(10-14-21)17(2)26/h7-14H,3-6,15-16H2,1-2H3,(H,25,28) |
| InChIKey | OPHLVWYWCGGDFP-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|