C17H24N2O6 — CID 7197601
[2-(3,4-diethoxyanilino)-2-oxoethyl] 3-acetamidopropanoate (PubChem CID 7197601) has the molecular formula C17H24N2O6 and a molecular weight of 352.39 g/mol. Its IUPAC name is [2-(3,4-diethoxyanilino)-2-oxoethyl] 3-acetamidopropanoate.
| Compound Name | [2-(3,4-diethoxyanilino)-2-oxoethyl] 3-acetamidopropanoate |
|---|---|
| PubChem CID | 7197601 |
| Molecular Formula | C17H24N2O6 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | [2-(3,4-diethoxyanilino)-2-oxoethyl] 3-acetamidopropanoate |
| SMILES | CCOc1ccc(NC(=O)COC(=O)CCNC(C)=O)cc1OCC |
| InChI | InChI=1S/C17H24N2O6/c1-4-23-14-7-6-13(10-15(14)24-5-2)19-16(21)11-25-17(22)8-9-18-12(3)20/h6-7,10H,4-5,8-9,11H2,1-3H3,(H,18,20)(H,19,21) |
| InChIKey | DKYILWOEYABEDZ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |