C22H27NO6 — CID 8918544
[2-(3,4-diethoxyanilino)-2-oxoethyl] 2-(2,5-dimethylphenoxy)acetate (PubChem CID 8918544) has the molecular formula C22H27NO6 and a molecular weight of 401.46 g/mol. Its IUPAC name is [2-(3,4-diethoxyanilino)-2-oxoethyl] 2-(2,5-dimethylphenoxy)acetate.
| Compound Name | [2-(3,4-diethoxyanilino)-2-oxoethyl] 2-(2,5-dimethylphenoxy)acetate |
|---|---|
| PubChem CID | 8918544 |
| Molecular Formula | C22H27NO6 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | [2-(3,4-diethoxyanilino)-2-oxoethyl] 2-(2,5-dimethylphenoxy)acetate |
| SMILES | CCOc1ccc(NC(=O)COC(=O)COc2cc(C)ccc2C)cc1OCC |
| InChI | InChI=1S/C22H27NO6/c1-5-26-18-10-9-17(12-20(18)27-6-2)23-21(24)13-29-22(25)14-28-19-11-15(3)7-8-16(19)4/h7-12H,5-6,13-14H2,1-4H3,(H,23,24) |
| InChIKey | JWNQKQRGYVZQBT-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |