C13H15FN2O4 — CID 7197279
[2-(3-fluoroanilino)-2-oxoethyl] 3-acetamidopropanoate (PubChem CID 7197279) has the molecular formula C13H15FN2O4 and a molecular weight of 282.27 g/mol. Its IUPAC name is [2-(3-fluoroanilino)-2-oxoethyl] 3-acetamidopropanoate.
| Compound Name | [2-(3-fluoroanilino)-2-oxoethyl] 3-acetamidopropanoate |
|---|---|
| PubChem CID | 7197279 |
| Molecular Formula | C13H15FN2O4 |
| Molecular Weight | 282.27 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | [2-(3-fluoroanilino)-2-oxoethyl] 3-acetamidopropanoate |
| SMILES | CC(=O)NCCC(=O)OCC(=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C13H15FN2O4/c1-9(17)15-6-5-13(19)20-8-12(18)16-11-4-2-3-10(14)7-11/h2-4,7H,5-6,8H2,1H3,(H,15,17)(H,16,18) |
| InChIKey | NNQLHNMTRVLURR-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.27 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |