C18H18FNO5S — CID 7168529
[2-(3-fluoroanilino)-2-oxoethyl] 3-(4-methylphenyl)sulfonylpropanoate (PubChem CID 7168529) has the molecular formula C18H18FNO5S and a molecular weight of 379.41 g/mol. Its IUPAC name is [2-(3-fluoroanilino)-2-oxoethyl] 3-(4-methylphenyl)sulfonylpropanoate.
| Compound Name | [2-(3-fluoroanilino)-2-oxoethyl] 3-(4-methylphenyl)sulfonylpropanoate |
|---|---|
| PubChem CID | 7168529 |
| Molecular Formula | C18H18FNO5S |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | [2-(3-fluoroanilino)-2-oxoethyl] 3-(4-methylphenyl)sulfonylpropanoate |
| SMILES | Cc1ccc(S(=O)(=O)CCC(=O)OCC(=O)Nc2cccc(F)c2)cc1 |
| InChI | InChI=1S/C18H18FNO5S/c1-13-5-7-16(8-6-13)26(23,24)10-9-18(22)25-12-17(21)20-15-4-2-3-14(19)11-15/h2-8,11H,9-10,12H2,1H3,(H,20,21) |
| InChIKey | POWUYFWCTFMPHK-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |