C17H23NO5 — CID 8759935
[2-(3,4-diethoxyanilino)-2-oxoethyl] 3-methylbut-2-enoate (PubChem CID 8759935) has the molecular formula C17H23NO5 and a molecular weight of 321.37 g/mol. Its IUPAC name is [2-(3,4-diethoxyanilino)-2-oxoethyl] 3-methylbut-2-enoate.
| Compound Name | [2-(3,4-diethoxyanilino)-2-oxoethyl] 3-methylbut-2-enoate |
|---|---|
| PubChem CID | 8759935 |
| Molecular Formula | C17H23NO5 |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | [2-(3,4-diethoxyanilino)-2-oxoethyl] 3-methylbut-2-enoate |
| SMILES | CCOc1ccc(NC(=O)COC(=O)C=C(C)C)cc1OCC |
| InChI | InChI=1S/C17H23NO5/c1-5-21-14-8-7-13(10-15(14)22-6-2)18-16(19)11-23-17(20)9-12(3)4/h7-10H,5-6,11H2,1-4H3,(H,18,19) |
| InChIKey | CYBVOOSLMAAOSK-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|