C15H19NO3 — CID 2357886
[2-(3,5-dimethylanilino)-2-oxoethyl] 3-methylbut-2-enoate (PubChem CID 2357886) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is [2-(3,5-dimethylanilino)-2-oxoethyl] 3-methylbut-2-enoate.
| Compound Name | [2-(3,5-dimethylanilino)-2-oxoethyl] 3-methylbut-2-enoate |
|---|---|
| PubChem CID | 2357886 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | [2-(3,5-dimethylanilino)-2-oxoethyl] 3-methylbut-2-enoate |
| SMILES | CC(C)=CC(=O)OCC(=O)Nc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C15H19NO3/c1-10(2)5-15(18)19-9-14(17)16-13-7-11(3)6-12(4)8-13/h5-8H,9H2,1-4H3,(H,16,17) |
| InChIKey | RKOQCPBPDIAPSE-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|