C22H36N2O4 — CID 142531824
ethane;ethyl (3E)-3-[2-(3,5-dimethylanilino)-2-oxoethoxy]imino-2,2-diethylbutanoate (PubChem CID 142531824) has the molecular formula C22H36N2O4 and a molecular weight of 392.54 g/mol. Its IUPAC name is ethane;ethyl (3E)-3-[2-(3,5-dimethylanilino)-2-oxoethoxy]imino-2,2-diethylbutanoate.
| Compound Name | ethane;ethyl (3E)-3-[2-(3,5-dimethylanilino)-2-oxoethoxy]imino-2,2-diethylbutanoate |
|---|---|
| PubChem CID | 142531824 |
| Molecular Formula | C22H36N2O4 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.27 |
| IUPAC Name | ethane;ethyl (3E)-3-[2-(3,5-dimethylanilino)-2-oxoethoxy]imino-2,2-diethylbutanoate |
| SMILES | CC.CCOC(=O)C(CC)(CC)/C(C)=N/OCC(=O)Nc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C20H30N2O4.C2H6/c1-7-20(8-2,19(24)25-9-3)16(6)22-26-13-18(23)21-17-11-14(4)10-15(5)12-17;1-2/h10-12H,7-9,13H2,1-6H3,(H,21,23);1-2H3/b22-16+; |
| InChIKey | MIXGVDZZHRLIEA-YHLMHSEJSA-N |
| XLogP | 5.03 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|