C23H38N2O4 — CID 142531834
ethane;ethyl (3E)-3-[2-(3,5-dimethylanilino)-2-oxoethoxy]imino-4-ethyl-4-methylhexanoate (PubChem CID 142531834) has the molecular formula C23H38N2O4 and a molecular weight of 406.57 g/mol. Its IUPAC name is ethane;ethyl (3E)-3-[2-(3,5-dimethylanilino)-2-oxoethoxy]imino-4-ethyl-4-methylhexanoate.
| Compound Name | ethane;ethyl (3E)-3-[2-(3,5-dimethylanilino)-2-oxoethoxy]imino-4-ethyl-4-methylhexanoate |
|---|---|
| PubChem CID | 142531834 |
| Molecular Formula | C23H38N2O4 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.28 |
| IUPAC Name | ethane;ethyl (3E)-3-[2-(3,5-dimethylanilino)-2-oxoethoxy]imino-4-ethyl-4-methylhexanoate |
| SMILES | CC.CCOC(=O)C/C(=N\OCC(=O)Nc1cc(C)cc(C)c1)C(C)(CC)CC |
| InChI | InChI=1S/C21H32N2O4.C2H6/c1-7-21(6,8-2)18(13-20(25)26-9-3)23-27-14-19(24)22-17-11-15(4)10-16(5)12-17;1-2/h10-12H,7-9,13-14H2,1-6H3,(H,22,24);1-2H3/b23-18+; |
| InChIKey | KYXNKHAUQOOQSK-XHMOQMQQSA-N |
| XLogP | 5.42 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|