C13H13ClFNO3 — CID 2567101
[2-(3-chloro-4-fluoroanilino)-2-oxoethyl] 3-methylbut-2-enoate (PubChem CID 2567101) has the molecular formula C13H13ClFNO3 and a molecular weight of 285.70 g/mol. Its IUPAC name is [2-(3-chloro-4-fluoroanilino)-2-oxoethyl] 3-methylbut-2-enoate.
| Compound Name | [2-(3-chloro-4-fluoroanilino)-2-oxoethyl] 3-methylbut-2-enoate |
|---|---|
| PubChem CID | 2567101 |
| Molecular Formula | C13H13ClFNO3 |
| Molecular Weight | 285.70 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | [2-(3-chloro-4-fluoroanilino)-2-oxoethyl] 3-methylbut-2-enoate |
| SMILES | CC(C)=CC(=O)OCC(=O)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C13H13ClFNO3/c1-8(2)5-13(18)19-7-12(17)16-9-3-4-11(15)10(14)6-9/h3-6H,7H2,1-2H3,(H,16,17) |
| InChIKey | AUVJHSPUPZNYGN-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.70 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|