C18H14ClFN2O4 — CID 7881022
[2-(4-carbamoylanilino)-2-oxoethyl] (E)-3-(3-chloro-4-fluorophenyl)prop-2-enoate (PubChem CID 7881022) has the molecular formula C18H14ClFN2O4 and a molecular weight of 376.77 g/mol. Its IUPAC name is [2-(4-carbamoylanilino)-2-oxoethyl] (E)-3-(3-chloro-4-fluorophenyl)prop-2-enoate.
| Compound Name | [2-(4-carbamoylanilino)-2-oxoethyl] (E)-3-(3-chloro-4-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7881022 |
| Molecular Formula | C18H14ClFN2O4 |
| Molecular Weight | 376.77 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | [2-(4-carbamoylanilino)-2-oxoethyl] (E)-3-(3-chloro-4-fluorophenyl)prop-2-enoate |
| SMILES | NC(=O)c1ccc(NC(=O)COC(=O)/C=C/c2ccc(F)c(Cl)c2)cc1 |
| InChI | InChI=1S/C18H14ClFN2O4/c19-14-9-11(1-7-15(14)20)2-8-17(24)26-10-16(23)22-13-5-3-12(4-6-13)18(21)25/h1-9H,10H2,(H2,21,25)(H,22,23)/b8-2+ |
| InChIKey | ZMMWVNROKVCBTJ-KRXBUXKQSA-N |
| XLogP | 2.77 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.77 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|