C19H15ClFNO4 — CID 7880924
[2-(3-acetylanilino)-2-oxoethyl] (E)-3-(3-chloro-4-fluorophenyl)prop-2-enoate (PubChem CID 7880924) has the molecular formula C19H15ClFNO4 and a molecular weight of 375.78 g/mol. Its IUPAC name is [2-(3-acetylanilino)-2-oxoethyl] (E)-3-(3-chloro-4-fluorophenyl)prop-2-enoate.
| Compound Name | [2-(3-acetylanilino)-2-oxoethyl] (E)-3-(3-chloro-4-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7880924 |
| Molecular Formula | C19H15ClFNO4 |
| Molecular Weight | 375.78 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | [2-(3-acetylanilino)-2-oxoethyl] (E)-3-(3-chloro-4-fluorophenyl)prop-2-enoate |
| SMILES | CC(=O)c1cccc(NC(=O)COC(=O)/C=C/c2ccc(F)c(Cl)c2)c1 |
| InChI | InChI=1S/C19H15ClFNO4/c1-12(23)14-3-2-4-15(10-14)22-18(24)11-26-19(25)8-6-13-5-7-17(21)16(20)9-13/h2-10H,11H2,1H3,(H,22,24)/b8-6+ |
| InChIKey | NJNNOZZJSMJTTF-SOFGYWHQSA-N |
| XLogP | 3.88 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.78 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|