C22H24F2N2O4 — CID 30315978
[2-(4-tert-butylanilino)-2-oxoethyl] 3-[(2,4-difluorobenzoyl)amino]propanoate (PubChem CID 30315978) has the molecular formula C22H24F2N2O4 and a molecular weight of 418.44 g/mol. Its IUPAC name is [2-(4-tert-butylanilino)-2-oxoethyl] 3-[(2,4-difluorobenzoyl)amino]propanoate.
| Compound Name | [2-(4-tert-butylanilino)-2-oxoethyl] 3-[(2,4-difluorobenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 30315978 |
| Molecular Formula | C22H24F2N2O4 |
| Molecular Weight | 418.44 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | [2-(4-tert-butylanilino)-2-oxoethyl] 3-[(2,4-difluorobenzoyl)amino]propanoate |
| SMILES | CC(C)(C)c1ccc(NC(=O)COC(=O)CCNC(=O)c2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C22H24F2N2O4/c1-22(2,3)14-4-7-16(8-5-14)26-19(27)13-30-20(28)10-11-25-21(29)17-9-6-15(23)12-18(17)24/h4-9,12H,10-11,13H2,1-3H3,(H,25,29)(H,26,27) |
| InChIKey | ZBPGJRWYLFDRDO-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.44 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |